![[ICO]](/icons/blank.gif){kind=icon}
|
Name | Last modified | Size | Description |
|---|---|---|---|---|
|
Parent Directory | - | ||
|
A Black Rose Burial | 20-Apr-2018 16:20 | - | |
|
A Kombi | 20-Apr-2018 16:20 | - | |
|
A Máscingók (Mácsingó Family) | 20-Apr-2018 16:20 | - | |
|
Abrar-ul-Haq | 20-Apr-2018 16:20 | - | |
|
Adam Edwards | 20-Apr-2018 16:20 | - | |
|
Ade Payne | 20-Apr-2018 16:20 | - | |
|
Ajad | 20-Apr-2018 16:20 | - | |
|
Akerbeltz | 20-Apr-2018 16:20 | - | |
|
Aleksandrs Daškovs | 20-Apr-2018 16:20 | - | |
|
Alison Vardy | 20-Apr-2018 16:20 | - | |
|
Amica | 20-Apr-2018 16:20 | - | |
|
Andersen Viana | 20-Apr-2018 16:20 | - | |
|
Andronicus | 20-Apr-2018 16:20 | - | |
|
AndyOp | 20-Apr-2018 16:20 | - | |
|
Anton and The Headcleaners | 20-Apr-2018 16:20 | - | |
|
Arkè String Project | 20-Apr-2018 16:20 | - | |
|
As Ashes Fall | 20-Apr-2018 16:20 | - | |
|
Audision | 20-Apr-2018 16:20 | - | |
|
Authorize | 20-Apr-2018 16:20 | - | |
|
Bach; Gordon Fergus-Thompson | 20-Apr-2018 16:20 | - | |
|
Banda Sinfónica Militar "25 de Mayo" | 20-Apr-2018 16:20 | - | |
|
Bang! Bang! | 20-Apr-2018 16:20 | - | |
|
Barnard's Star | 20-Apr-2018 16:20 | - | |
|
Be-Papas | 20-Apr-2018 16:20 | - | |
|
Ben Businovski | 20-Apr-2018 16:20 | - | |
|
Ben Lear | 20-Apr-2018 16:20 | - | |
|
Blacka'nized | 20-Apr-2018 16:20 | - | |
|
Bobby Sixkiller | 20-Apr-2018 16:20 | - | |
|
Bonnie Foreman | 20-Apr-2018 16:20 | - | |
|
Boogie Shoes | 20-Apr-2018 16:20 | - | |
|
Boohoos | 20-Apr-2018 16:20 | - | |
|
Boquinha Da Garrafa | 20-Apr-2018 16:20 | - | |
|
Bruce Keen & David Chong | 20-Apr-2018 16:20 | - | |
|
Bukan Jatt & Miss Shabana | 20-Apr-2018 16:20 | - | |
|
Byron G. Harlan & Joseph Belmont | 20-Apr-2018 16:20 | - | |
|
Caliber | 20-Apr-2018 16:20 | - | |
|
Carla Lipp | 20-Apr-2018 16:20 | - | |
|
Carlas | 20-Apr-2018 16:20 | - | |
|
Casket Salesmen | 20-Apr-2018 16:20 | - | |
|
Cephusion | 20-Apr-2018 16:20 | - | |
|
Chris Wyatt Scott | 20-Apr-2018 16:20 | - | |
|
Clear Tigers | 20-Apr-2018 16:20 | - | |
|
Clint Mansell & Sam Hulick | 20-Apr-2018 16:20 | - | |
|
Complys | 20-Apr-2018 16:20 | - | |
|
DJ Cerla & Moratto | 20-Apr-2018 16:20 | - | |
|
DJ Side | 20-Apr-2018 16:20 | - | |
|
DMT | 20-Apr-2018 16:20 | - | |
|
DO | 20-Apr-2018 16:20 | - | |
|
Daggers Mid Flight | 20-Apr-2018 16:20 | - | |
|
Daiquiri | 20-Apr-2018 16:20 | - | |
|
Daniele Alexander | 20-Apr-2018 16:20 | - | |
|
Danny's Last Dance | 20-Apr-2018 16:20 | - | |
|
David Houston & Barbara Mandrell | 20-Apr-2018 16:20 | - | |
|
Dead Leaves Rising | 20-Apr-2018 16:20 | - | |
|
Delray | 20-Apr-2018 16:20 | - | |
|
Die Radierer | 20-Apr-2018 16:20 | - | |
|
Dona Confuse | 20-Apr-2018 16:20 | - | |
|
Drowsy | 20-Apr-2018 16:20 | - | |
|
E-Praise | 20-Apr-2018 16:20 | - | |
|
Eastmountainsouth | 20-Apr-2018 16:20 | - | |
|
Eat Sugar | 20-Apr-2018 16:20 | - | |
|
Eigen-Wijs | 20-Apr-2018 16:20 | - | |
|
Elim Hall | 20-Apr-2018 16:20 | - | |
|
Embodiment 12:14 | 20-Apr-2018 16:20 | - | |
|
Ennui | 20-Apr-2018 16:20 | - | |
|
Examine | 20-Apr-2018 16:20 | - | |
|
Exodus | 20-Apr-2018 16:20 | - | |
|
Fascia | 20-Apr-2018 16:20 | - | |
|
Ferrier | 20-Apr-2018 16:20 | - | |
|
First Signs of Frost | 20-Apr-2018 16:20 | - | |
|
Freddie Gibbs & Statik Selektah | 20-Apr-2018 16:20 | - | |
|
Fun Horns | 20-Apr-2018 16:20 | - | |
|
Færd | 20-Apr-2018 16:20 | - | |
|
GLOW | 20-Apr-2018 16:20 | - | |
|
Gene Rice | 20-Apr-2018 16:20 | - | |
|
Georgia Guidestones | 20-Apr-2018 16:20 | - | |
|
Goryptic | 20-Apr-2018 16:20 | - | |
|
Groupe Rétro | 20-Apr-2018 16:20 | - | |
|
Grussner and Pohjola | 20-Apr-2018 16:20 | - | |
|
Head West | 20-Apr-2018 16:20 | - | |
|
Hedge & Donna | 20-Apr-2018 16:20 | - | |
|
Honeyroot | 20-Apr-2018 16:20 | - | |
|
Hot Club de Norvège, Ola Kvernberg & Jimmy Rosenberg | 20-Apr-2018 16:20 | - | |
|
Human Hands | 20-Apr-2018 16:20 | - | |
|
Hybrid Constellation | 20-Apr-2018 16:20 | - | |
|
IRISH LANDSCAPE BAND | 20-Apr-2018 16:20 | - | |
|
In Death I Trust | 20-Apr-2018 16:20 | - | |
|
Ingram Washington | 20-Apr-2018 16:20 | - | |
|
Initia | 20-Apr-2018 16:20 | - | |
|
Inner Thought | 20-Apr-2018 16:20 | - | |
|
Innergaze | 20-Apr-2018 16:20 | - | |
|
Irreverencias | 20-Apr-2018 16:20 | - | |
|
J Brothers | 20-Apr-2018 16:20 | - | |
|
JDT | 20-Apr-2018 16:20 | - | |
|
Jakob Dinesen ⁄ Kurt Rosenwinkel | 20-Apr-2018 16:20 | - | |
|
Jane Pow | 20-Apr-2018 16:20 | - | |
|
Jessica Lowndes | 20-Apr-2018 16:20 | - | |
|
Jih | 20-Apr-2018 16:20 | - | |
|
Jill | 20-Apr-2018 16:20 | - | |
|
Jim & Tammy & Their Friends | 20-Apr-2018 16:20 | - | |
|
Jochanan Shelliem | 20-Apr-2018 16:20 | - | |
|
Joga | 20-Apr-2018 16:20 | - | |
|
John Moore | 20-Apr-2018 16:20 | - | |
|
Jorge Bonfá | 20-Apr-2018 16:20 | - | |
|
Julian Liberator and Guy McAffer | 20-Apr-2018 16:20 | - | |
|
K-9 Posse | 20-Apr-2018 16:20 | - | |
|
Kathy McGinty | 20-Apr-2018 16:20 | - | |
|
Kindablu | 20-Apr-2018 16:20 | - | |
|
LaCalle Familia | 20-Apr-2018 16:20 | - | |
|
Lance Inc. | 20-Apr-2018 16:20 | - | |
|
Landfill | 20-Apr-2018 16:20 | - | |
|
Lange Jojo | 20-Apr-2018 16:20 | - | |
|
Lash | 20-Apr-2018 16:20 | - | |
|
Laura Junson | 20-Apr-2018 16:20 | - | |
|
Laurie Lannes | 20-Apr-2018 16:20 | - | |
|
Lautmusik | 20-Apr-2018 16:20 | - | |
|
Les Maledictus Sound | 20-Apr-2018 16:20 | - | |
|
Let Lions | 20-Apr-2018 16:20 | - | |
|
Lillja | 20-Apr-2018 16:20 | - | |
|
Lindsay Mac | 20-Apr-2018 16:20 | - | |
|
Lionel Hampton Orchestra | 20-Apr-2018 16:20 | - | |
|
Lisa Lavie | 20-Apr-2018 16:20 | - | |
|
Little Casper & the MX's | 20-Apr-2018 16:20 | - | |
|
Loar Gann | 20-Apr-2018 16:20 | - | |
|
Longevity | 20-Apr-2018 16:20 | - | |
|
Lonnie Walker | 20-Apr-2018 16:20 | - | |
|
Lorenzo Arruga & Dave Lombardo | 20-Apr-2018 16:20 | - | |
|
Lou Silvestri & Jim Karolides | 20-Apr-2018 16:20 | - | |
|
Luminfire | 20-Apr-2018 16:20 | - | |
|
MOBS | 20-Apr-2018 16:20 | - | |
|
Make Good Your Escape | 20-Apr-2018 16:20 | - | |
|
Manboy | 20-Apr-2018 16:20 | - | |
|
Marax | 20-Apr-2018 16:20 | - | |
|
Marching Royal Dukes | 20-Apr-2018 16:20 | - | |
|
Maria Misgeld Olof Misgeld Olle Lindvall | 20-Apr-2018 16:20 | - | |
|
Mario Mathy | 20-Apr-2018 16:20 | - | |
|
Meroz | 20-Apr-2018 16:20 | - | |
|
Michael Aranda & Alex Day | 20-Apr-2018 16:20 | - | |
|
Michael Breen | 20-Apr-2018 16:20 | - | |
|
Michael Mike | 20-Apr-2018 16:20 | - | |
|
Mightiest | 20-Apr-2018 16:20 | - | |
|
Mike Harding | 20-Apr-2018 16:20 | - | |
|
Missill | 20-Apr-2018 16:20 | - | |
|
Moray Eel | 20-Apr-2018 16:20 | - | |
|
Mukhtar Begum | 20-Apr-2018 16:20 | - | |
|
Myalansky & Joe Mafia | 20-Apr-2018 16:20 | - | |
|
Myles Cochran | 20-Apr-2018 16:20 | - | |
|
Nadia Sohaei | 20-Apr-2018 16:20 | - | |
|
Nadieh | 20-Apr-2018 16:20 | - | |
|
Nautic | 20-Apr-2018 16:20 | - | |
|
Neuma | 20-Apr-2018 16:20 | - | |
|
Neztic & Vate | 20-Apr-2018 16:20 | - | |
|
Niki Belucci | 20-Apr-2018 16:20 | - | |
|
Ninni Poijärvi | 20-Apr-2018 16:20 | - | |
|
No Pride | 20-Apr-2018 16:20 | - | |
|
No Way Out | 20-Apr-2018 16:20 | - | |
|
Nolderise | 20-Apr-2018 16:20 | - | |
|
Noorda | 20-Apr-2018 16:20 | - | |
|
North Pole Fisherman's Association | 20-Apr-2018 16:20 | - | |
|
Nu-Sound Express, Ltd. | 20-Apr-2018 16:20 | - | |
|
Out of Body | 20-Apr-2018 16:20 | - | |
|
PATS | 20-Apr-2018 16:20 | - | |
|
Palapeli | 20-Apr-2018 16:20 | - | |
|
Paradigma | 20-Apr-2018 16:20 | - | |
|
Pau Hana | 20-Apr-2018 16:20 | - | |
|
Paul Clarvis & Liam Noble | 20-Apr-2018 16:20 | - | |
|
Paulo Martelli | 20-Apr-2018 16:20 | - | |
|
Peligro | 20-Apr-2018 16:20 | - | |
|
Phantom | 20-Apr-2018 16:20 | - | |
|
Phil Woods & Gene Quill | 20-Apr-2018 16:20 | - | |
|
Philly's Most | 20-Apr-2018 16:20 | - | |
|
Piperactive | 20-Apr-2018 16:20 | - | |
|
Polygon Ring | 20-Apr-2018 16:20 | - | |
|
Professor Bob Brier | 20-Apr-2018 16:20 | - | |
|
Psenicka & The Boys | 20-Apr-2018 16:20 | - | |
|
Puppa J & Tasottavat | 20-Apr-2018 16:20 | - | |
|
Puppet Mammy | 20-Apr-2018 16:20 | - | |
|
Push | 20-Apr-2018 16:20 | - | |
|
Rainbow Chasers | 20-Apr-2018 16:20 | - | |
|
Reneé García | 20-Apr-2018 16:20 | - | |
|
Reportaż | 20-Apr-2018 16:20 | - | |
|
Rich Shapero | 20-Apr-2018 16:20 | - | |
|
River People | 20-Apr-2018 16:20 | - | |
|
Rob Wright | 20-Apr-2018 16:20 | - | |
|
Rox Rox | 20-Apr-2018 16:20 | - | |
|
Runic | 20-Apr-2018 16:20 | - | |
|
Runnin' Wild | 20-Apr-2018 16:20 | - | |
|
Sathanas | 20-Apr-2018 16:20 | - | |
|
Satura Lanx | 20-Apr-2018 16:20 | - | |
|
Screendeath | 20-Apr-2018 16:20 | - | |
|
Sera Hill | 20-Apr-2018 16:20 | - | |
|
Serge Gainsbourg & Michel Colombier | 20-Apr-2018 16:20 | - | |
|
Señor Mostaza | 20-Apr-2018 16:20 | - | |
|
Simone Solga | 20-Apr-2018 16:20 | - | |
|
Slaughter Command | 20-Apr-2018 16:20 | - | |
|
Sleepy Horses | 20-Apr-2018 16:20 | - | |
|
Smalltown Collective | 20-Apr-2018 16:20 | - | |
|
Stephen McKeon | 20-Apr-2018 16:20 | - | |
|
Stephen Van Händel | 20-Apr-2018 16:20 | - | |
|
Superjeg | 20-Apr-2018 16:20 | - | |
|
Svalbard | 20-Apr-2018 16:20 | - | |
|
Tafo Brothers | 20-Apr-2018 16:20 | - | |
|
Teknostep | 20-Apr-2018 16:20 | - | |
|
Terius Nash | 20-Apr-2018 16:20 | - | |
|
The Blueprint | 20-Apr-2018 16:20 | - | |
|
The Diff'rent Stripes | 20-Apr-2018 16:20 | - | |
|
The George Shearing Quintet with Nancy Wilson | 20-Apr-2018 16:20 | - | |
|
The Impossible 5 | 20-Apr-2018 16:20 | - | |
|
The Last Good Year | 20-Apr-2018 16:20 | - | |
|
The List | 20-Apr-2018 16:20 | - | |
|
The LoneTones | 20-Apr-2018 16:20 | - | |
|
The Loose Cannons | 20-Apr-2018 16:20 | - | |
|
The Memory Foundation | 20-Apr-2018 16:20 | - | |
|
The Missing Parts | 20-Apr-2018 16:20 | - | |
|
The Reaction | 20-Apr-2018 16:20 | - | |
|
The Rituals | 20-Apr-2018 16:20 | - | |
|
The Six and Violence | 20-Apr-2018 16:20 | - | |
|
The Sky Corvair | 20-Apr-2018 16:20 | - | |
|
The Suburban Nightmare | 20-Apr-2018 16:20 | - | |
|
The Swing Session | 20-Apr-2018 16:20 | - | |
|
The Trademark | 20-Apr-2018 16:20 | - | |
|
The Trey Gunn Band | 20-Apr-2018 16:20 | - | |
|
The Ökrös Ensemble | 20-Apr-2018 16:20 | - | |
|
TheTheThes | 20-Apr-2018 16:20 | - | |
|
This Is the Hello Monster ! | 20-Apr-2018 16:20 | - | |
|
Tina Turner duet with David Bowie | 20-Apr-2018 16:20 | - | |
|
Tom Kimmel | 20-Apr-2018 16:20 | - | |
|
Trax 4 Daze | 20-Apr-2018 16:20 | - | |
|
Uglystick | 20-Apr-2018 16:20 | - | |
|
Unity Reggae Band | 20-Apr-2018 16:20 | - | |
|
Urban Farmers | 20-Apr-2018 16:20 | - | |
|
Vzyadoq Moe | 20-Apr-2018 16:20 | - | |
|
Warm in the Wake | 20-Apr-2018 16:20 | - | |
|
Weaver | 20-Apr-2018 16:20 | - | |
|
Weird Children | 20-Apr-2018 16:20 | - | |
|
Wild Mango | 20-Apr-2018 16:20 | - | |
|
X:Tend | 20-Apr-2018 16:20 | - | |
|
YEEAAAH! | 20-Apr-2018 16:20 | - | |
|
YoggyOne | 20-Apr-2018 16:20 | - | |
|
Zapata | 20-Apr-2018 16:20 | - | |
|
Zapp Zapp | 20-Apr-2018 16:20 | - | |
|
Zespół Browar Żywiec | 20-Apr-2018 16:20 | - | |
|
Zoar | 20-Apr-2018 16:20 | - | |
|
Zolo | 20-Apr-2018 16:20 | - | |
|
eaststrikewest | 20-Apr-2018 16:20 | - | |
|
Živo Blato | 20-Apr-2018 16:20 | - | |
|
Виноградный день | 20-Apr-2018 16:20 | - | |
|
Язык Дождя | 20-Apr-2018 16:20 | - | |
|
矢堀孝一 | 20-Apr-2018 16:20 | - | |
|
臼井嗣人 | 20-Apr-2018 16:20 | - | |